C16H22N4O — CID 167192487
8-(cyclopropylmethyl)-5,12-dimethyl-1,3,8,12-tetrazatricyclo[8.4.0.02,7]tetradeca-2(7),3,5-trien-9-one (PubChem CID 167192487) has the molecular formula C16H22N4O and a molecular weight of 286.38 g/mol. Its IUPAC name is 8-(cyclopropylmethyl)-5,12-dimethyl-1,3,8,12-tetrazatricyclo[8.4.0.02,7]tetradeca-2(7),3,5-trien-9-one.
| Compound Name | 8-(cyclopropylmethyl)-5,12-dimethyl-1,3,8,12-tetrazatricyclo[8.4.0.02,7]tetradeca-2(7),3,5-trien-9-one |
|---|---|
| PubChem CID | 167192487 |
| Molecular Formula | C16H22N4O |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.18 |
| IUPAC Name | 8-(cyclopropylmethyl)-5,12-dimethyl-1,3,8,12-tetrazatricyclo[8.4.0.02,7]tetradeca-2(7),3,5-trien-9-one |
| SMILES | Cc1cnc2c(c1)N(CC1CC1)C(=O)C1CN(C)CCN21 |
| InChI | InChI=1S/C16H22N4O/c1-11-7-13-15(17-8-11)19-6-5-18(2)10-14(19)16(21)20(13)9-12-3-4-12/h7-8,12,14H,3-6,9-10H2,1-2H3 |
| InChIKey | ONOYVRZQSQIELL-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 39.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |