C13H17IN4O — CID 167192503
5-iodo-8,13-dimethyl-1,3,8,13-tetrazatricyclo[9.4.0.02,7]pentadeca-2(7),3,5-trien-9-one (PubChem CID 167192503) has the molecular formula C13H17IN4O and a molecular weight of 372.21 g/mol. Its IUPAC name is 5-iodo-8,13-dimethyl-1,3,8,13-tetrazatricyclo[9.4.0.02,7]pentadeca-2(7),3,5-trien-9-one.
| Compound Name | 5-iodo-8,13-dimethyl-1,3,8,13-tetrazatricyclo[9.4.0.02,7]pentadeca-2(7),3,5-trien-9-one |
|---|---|
| PubChem CID | 167192503 |
| Molecular Formula | C13H17IN4O |
| Molecular Weight | 372.21 g/mol |
| Exact Mass | 372.04 |
| IUPAC Name | 5-iodo-8,13-dimethyl-1,3,8,13-tetrazatricyclo[9.4.0.02,7]pentadeca-2(7),3,5-trien-9-one |
| SMILES | CN1CCN2c3ncc(I)cc3N(C)C(=O)CC2C1 |
| InChI | InChI=1S/C13H17IN4O/c1-16-3-4-18-10(8-16)6-12(19)17(2)11-5-9(14)7-15-13(11)18/h5,7,10H,3-4,6,8H2,1-2H3 |
| InChIKey | RZSVTEOEPWIBRJ-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 39.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.21 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|