About (6E)-5-butyl-12-fluoro-5,7-dimethyldodeca-1,6-dien-8-yne
(6E)-5-butyl-12-fluoro-5,7-dimethyldodeca-1,6-dien-8-yne (PubChem CID 167192669) has the molecular formula C18H29F
and a molecular weight of 264.43 g/mol. Its IUPAC name is (6E)-5-butyl-12-fluoro-5,7-dimethyldodeca-1,6-dien-8-yne.
Molecular Properties
| Compound Name | (6E)-5-butyl-12-fluoro-5,7-dimethyldodeca-1,6-dien-8-yne |
| PubChem CID | 167192669 |
| Molecular Formula | C18H29F |
| Molecular Weight | 264.43 g/mol |
| Exact Mass | 264.23 |
| IUPAC Name | (6E)-5-butyl-12-fluoro-5,7-dimethyldodeca-1,6-dien-8-yne |
| SMILES | C=CCCC(C)(/C=C(\C)C#CCCCF)CCCC |
| InChI | InChI=1S/C18H29F/c1-5-7-13-18(4,14-8-6-2)16-17(3)12-10-9-11-15-19/h5,16H,1,6-9,11,13-15H2,2-4H3/b17-16+ |
| InChIKey | CQSAEIVUBCEHCY-WUKNDPDISA-N |
| XLogP | 5.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 264.43 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (6E)-5-butyl-12-fluoro-5,7-dimethyldodeca-1,6-dien-8-yne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6E)-5-butyl-12-fluoro-5,7-dimethyldodeca-1,6-dien-8-yne?
The IUPAC name of (6E)-5-butyl-12-fluoro-5,7-dimethyldodeca-1,6-dien-8-yne (CID 167192669) is (6E)-5-butyl-12-fluoro-5,7-dimethyldodeca-1,6-dien-8-yne.
What is the SMILES notation for (6E)-5-butyl-12-fluoro-5,7-dimethyldodeca-1,6-dien-8-yne?
The canonical SMILES for (6E)-5-butyl-12-fluoro-5,7-dimethyldodeca-1,6-dien-8-yne is C=CCCC(C)(/C=C(\C)C#CCCCF)CCCC.
What is the InChIKey of (6E)-5-butyl-12-fluoro-5,7-dimethyldodeca-1,6-dien-8-yne?
The InChIKey is CQSAEIVUBCEHCY-WUKNDPDISA-N. The full InChI is InChI=1S/C18H29F/c1-5-7-13-18(4,14-8-6-2)16-17(3)12-10-9-11-15-19/h5,16H,1,6-9,11,13-15H2,2-4H3/b17-16+.
What are the key properties of (6E)-5-butyl-12-fluoro-5,7-dimethyldodeca-1,6-dien-8-yne?
(6E)-5-butyl-12-fluoro-5,7-dimethyldodeca-1,6-dien-8-yne has a molecular weight of 264.43 g/mol, XLogP of 5.85, 9 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (6E)-5-butyl-12-fluoro-5,7-dimethyldodeca-1,6-dien-8-yne is sourced from PubChem (CID 167192669), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).