About 6-propan-2-yl-3,7-dihydro-2H-cyclohepta[b]furan
6-propan-2-yl-3,7-dihydro-2H-cyclohepta[b]furan (PubChem CID 167192777) has the molecular formula C12H16O
and a molecular weight of 176.26 g/mol. Its IUPAC name is 6-propan-2-yl-3,7-dihydro-2H-cyclohepta[b]furan.
Molecular Properties
| Compound Name | 6-propan-2-yl-3,7-dihydro-2H-cyclohepta[b]furan |
| PubChem CID | 167192777 |
| Molecular Formula | C12H16O |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.12 |
| IUPAC Name | 6-propan-2-yl-3,7-dihydro-2H-cyclohepta[b]furan |
| SMILES | CC(C)C1=CC=C2CCOC2=CC1 |
| InChI | InChI=1S/C12H16O/c1-9(2)10-3-4-11-7-8-13-12(11)6-5-10/h3-4,6,9H,5,7-8H2,1-2H3 |
| InChIKey | LRGHCSSNTPDWBC-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-propan-2-yl-3,7-dihydro-2H-cyclohepta[b]furan with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-propan-2-yl-3,7-dihydro-2H-cyclohepta[b]furan?
The IUPAC name of 6-propan-2-yl-3,7-dihydro-2H-cyclohepta[b]furan (CID 167192777) is 6-propan-2-yl-3,7-dihydro-2H-cyclohepta[b]furan.
What is the SMILES notation for 6-propan-2-yl-3,7-dihydro-2H-cyclohepta[b]furan?
The canonical SMILES for 6-propan-2-yl-3,7-dihydro-2H-cyclohepta[b]furan is CC(C)C1=CC=C2CCOC2=CC1.
What is the InChIKey of 6-propan-2-yl-3,7-dihydro-2H-cyclohepta[b]furan?
The InChIKey is LRGHCSSNTPDWBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16O/c1-9(2)10-3-4-11-7-8-13-12(11)6-5-10/h3-4,6,9H,5,7-8H2,1-2H3.
What are the key properties of 6-propan-2-yl-3,7-dihydro-2H-cyclohepta[b]furan?
6-propan-2-yl-3,7-dihydro-2H-cyclohepta[b]furan has a molecular weight of 176.26 g/mol, XLogP of 3.20, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-propan-2-yl-3,7-dihydro-2H-cyclohepta[b]furan is sourced from PubChem (CID 167192777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).