C34H48N4O3S — CID 167192806
(2S)-1-[(2S)-3,3-dimethyl-2-(3,3,5,5-tetramethyloct-7-ynoylamino)butanoyl]-N-[[4-(4-methyl-1,3-thiazol-5-yl)phenyl]methyl]pyrrolidine-2-carboxamide (PubChem CID 167192806) has the molecular formula C34H48N4O3S and a molecular weight of 592.85 g/mol. Its IUPAC name is (2S)-1-[(2S)-3,3-dimethyl-2-(3,3,5,5-tetramethyloct-7-ynoylamino)butanoyl]-N-[[4-(4-methyl-1,3-thiazol-5-yl)phenyl]methyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-[(2S)-3,3-dimethyl-2-(3,3,5,5-tetramethyloct-7-ynoylamino)butanoyl]-N-[[4-(4-methyl-1,3-thiazol-5-yl)phenyl]methyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 167192806 |
| Molecular Formula | C34H48N4O3S |
| Molecular Weight | 592.85 g/mol |
| Exact Mass | 592.34 |
| IUPAC Name | (2S)-1-[(2S)-3,3-dimethyl-2-(3,3,5,5-tetramethyloct-7-ynoylamino)butanoyl]-N-[[4-(4-methyl-1,3-thiazol-5-yl)phenyl]methyl]pyrrolidine-2-carboxamide |
| SMILES | C#CCC(C)(C)CC(C)(C)CC(=O)N[C@H](C(=O)N1CCC[C@H]1C(=O)NCc1ccc(-c2scnc2C)cc1)C(C)(C)C |
| InChI | InChI=1S/C34H48N4O3S/c1-10-17-33(6,7)21-34(8,9)19-27(39)37-29(32(3,4)5)31(41)38-18-11-12-26(38)30(40)35-20-24-13-15-25(16-14-24)28-23(2)36-22-42-28/h1,13-16,22,26,29H,11-12,17-21H2,2-9H3,(H,35,40)(H,37,39)/t26-,29+/m0/s1 |
| InChIKey | UJQYSNOVDYYNFT-LITSAYRRSA-N |
| XLogP | 6.11 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.85 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|