About [(1E,3E)-4-carbazol-9-yl-1-iodopenta-1,3-dien-2-yl] prop-2-enoate
[(1E,3E)-4-carbazol-9-yl-1-iodopenta-1,3-dien-2-yl] prop-2-enoate (PubChem CID 167193129) has the molecular formula C20H16INO2
and a molecular weight of 429.26 g/mol. Its IUPAC name is [(1E,3E)-4-carbazol-9-yl-1-iodopenta-1,3-dien-2-yl] prop-2-enoate.
Molecular Properties
| Compound Name | [(1E,3E)-4-carbazol-9-yl-1-iodopenta-1,3-dien-2-yl] prop-2-enoate |
| PubChem CID | 167193129 |
| Molecular Formula | C20H16INO2 |
| Molecular Weight | 429.26 g/mol |
| Exact Mass | 429.02 |
| IUPAC Name | [(1E,3E)-4-carbazol-9-yl-1-iodopenta-1,3-dien-2-yl] prop-2-enoate |
| SMILES | C=CC(=O)OC(=C/I)/C=C(\C)n1c2ccccc2c2ccccc21 |
| InChI | InChI=1S/C20H16INO2/c1-3-20(23)24-15(13-21)12-14(2)22-18-10-6-4-8-16(18)17-9-5-7-11-19(17)22/h3-13H,1H2,2H3/b14-12+,15-13+ |
| InChIKey | IWENFBCMQLJHQX-QUMQEAAQSA-N |
| XLogP | 5.66 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 429.26 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze [(1E,3E)-4-carbazol-9-yl-1-iodopenta-1,3-dien-2-yl] prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1E,3E)-4-carbazol-9-yl-1-iodopenta-1,3-dien-2-yl] prop-2-enoate?
The IUPAC name of [(1E,3E)-4-carbazol-9-yl-1-iodopenta-1,3-dien-2-yl] prop-2-enoate (CID 167193129) is [(1E,3E)-4-carbazol-9-yl-1-iodopenta-1,3-dien-2-yl] prop-2-enoate.
What is the SMILES notation for [(1E,3E)-4-carbazol-9-yl-1-iodopenta-1,3-dien-2-yl] prop-2-enoate?
The canonical SMILES for [(1E,3E)-4-carbazol-9-yl-1-iodopenta-1,3-dien-2-yl] prop-2-enoate is C=CC(=O)OC(=C/I)/C=C(\C)n1c2ccccc2c2ccccc21.
What is the InChIKey of [(1E,3E)-4-carbazol-9-yl-1-iodopenta-1,3-dien-2-yl] prop-2-enoate?
The InChIKey is IWENFBCMQLJHQX-QUMQEAAQSA-N. The full InChI is InChI=1S/C20H16INO2/c1-3-20(23)24-15(13-21)12-14(2)22-18-10-6-4-8-16(18)17-9-5-7-11-19(17)22/h3-13H,1H2,2H3/b14-12+,15-13+.
What are the key properties of [(1E,3E)-4-carbazol-9-yl-1-iodopenta-1,3-dien-2-yl] prop-2-enoate?
[(1E,3E)-4-carbazol-9-yl-1-iodopenta-1,3-dien-2-yl] prop-2-enoate has a molecular weight of 429.26 g/mol, XLogP of 5.66, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(1E,3E)-4-carbazol-9-yl-1-iodopenta-1,3-dien-2-yl] prop-2-enoate is sourced from PubChem (CID 167193129), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).