About ethyl (2E)-2-(1,3-dioxoisoindol-2-yl)imino-3-oxo-3-phenylpropanoate
ethyl (2E)-2-(1,3-dioxoisoindol-2-yl)imino-3-oxo-3-phenylpropanoate (PubChem CID 16719401) has the molecular formula C19H14N2O5
and a molecular weight of 350.33 g/mol. Its IUPAC name is ethyl (2E)-2-(1,3-dioxoisoindol-2-yl)imino-3-oxo-3-phenylpropanoate.
Molecular Properties
| Compound Name | ethyl (2E)-2-(1,3-dioxoisoindol-2-yl)imino-3-oxo-3-phenylpropanoate |
| PubChem CID | 16719401 |
| Molecular Formula | C19H14N2O5 |
| Molecular Weight | 350.33 g/mol |
| Exact Mass | 350.09 |
| IUPAC Name | ethyl (2E)-2-(1,3-dioxoisoindol-2-yl)imino-3-oxo-3-phenylpropanoate |
| SMILES | CCOC(=O)/C(=N/N1C(=O)c2ccccc2C1=O)C(=O)c1ccccc1 |
| InChI | InChI=1S/C19H14N2O5/c1-2-26-19(25)15(16(22)12-8-4-3-5-9-12)20-21-17(23)13-10-6-7-11-14(13)18(21)24/h3-11H,2H2,1H3/b20-15+ |
| InChIKey | NSBNPZRJKBMGHZ-HMMYKYKNSA-N |
| XLogP | 2.08 |
| TPSA | 93.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.33 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze ethyl (2E)-2-(1,3-dioxoisoindol-2-yl)imino-3-oxo-3-phenylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (2E)-2-(1,3-dioxoisoindol-2-yl)imino-3-oxo-3-phenylpropanoate?
The IUPAC name of ethyl (2E)-2-(1,3-dioxoisoindol-2-yl)imino-3-oxo-3-phenylpropanoate (CID 16719401) is ethyl (2E)-2-(1,3-dioxoisoindol-2-yl)imino-3-oxo-3-phenylpropanoate.
What is the SMILES notation for ethyl (2E)-2-(1,3-dioxoisoindol-2-yl)imino-3-oxo-3-phenylpropanoate?
The canonical SMILES for ethyl (2E)-2-(1,3-dioxoisoindol-2-yl)imino-3-oxo-3-phenylpropanoate is CCOC(=O)/C(=N/N1C(=O)c2ccccc2C1=O)C(=O)c1ccccc1.
What is the InChIKey of ethyl (2E)-2-(1,3-dioxoisoindol-2-yl)imino-3-oxo-3-phenylpropanoate?
The InChIKey is NSBNPZRJKBMGHZ-HMMYKYKNSA-N. The full InChI is InChI=1S/C19H14N2O5/c1-2-26-19(25)15(16(22)12-8-4-3-5-9-12)20-21-17(23)13-10-6-7-11-14(13)18(21)24/h3-11H,2H2,1H3/b20-15+.
What are the key properties of ethyl (2E)-2-(1,3-dioxoisoindol-2-yl)imino-3-oxo-3-phenylpropanoate?
ethyl (2E)-2-(1,3-dioxoisoindol-2-yl)imino-3-oxo-3-phenylpropanoate has a molecular weight of 350.33 g/mol, XLogP of 2.08, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (2E)-2-(1,3-dioxoisoindol-2-yl)imino-3-oxo-3-phenylpropanoate is sourced from PubChem (CID 16719401), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).