About 1-ethenyl-4,5-dimethylpiperidin-2-one
1-ethenyl-4,5-dimethylpiperidin-2-one (PubChem CID 167194082) has the molecular formula C9H15NO
and a molecular weight of 153.22 g/mol. Its IUPAC name is 1-ethenyl-4,5-dimethylpiperidin-2-one.
Molecular Properties
| Compound Name | 1-ethenyl-4,5-dimethylpiperidin-2-one |
| PubChem CID | 167194082 |
| Molecular Formula | C9H15NO |
| Molecular Weight | 153.22 g/mol |
| Exact Mass | 153.12 |
| IUPAC Name | 1-ethenyl-4,5-dimethylpiperidin-2-one |
| SMILES | C=CN1CC(C)C(C)CC1=O |
| InChI | InChI=1S/C9H15NO/c1-4-10-6-8(3)7(2)5-9(10)11/h4,7-8H,1,5-6H2,2-3H3 |
| InChIKey | IFUWFHAHGZPKAC-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.22 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-ethenyl-4,5-dimethylpiperidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethenyl-4,5-dimethylpiperidin-2-one?
The IUPAC name of 1-ethenyl-4,5-dimethylpiperidin-2-one (CID 167194082) is 1-ethenyl-4,5-dimethylpiperidin-2-one.
What is the SMILES notation for 1-ethenyl-4,5-dimethylpiperidin-2-one?
The canonical SMILES for 1-ethenyl-4,5-dimethylpiperidin-2-one is C=CN1CC(C)C(C)CC1=O.
What is the InChIKey of 1-ethenyl-4,5-dimethylpiperidin-2-one?
The InChIKey is IFUWFHAHGZPKAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15NO/c1-4-10-6-8(3)7(2)5-9(10)11/h4,7-8H,1,5-6H2,2-3H3.
What are the key properties of 1-ethenyl-4,5-dimethylpiperidin-2-one?
1-ethenyl-4,5-dimethylpiperidin-2-one has a molecular weight of 153.22 g/mol, XLogP of 1.63, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethenyl-4,5-dimethylpiperidin-2-one is sourced from PubChem (CID 167194082), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).