C24H32N6O3S — CID 167194570
2-[[4-(dimethylamino)cyclohexyl]amino]-8-ethyl-6-[2-methoxy-6-(sulfinoamino)-3-pyridinyl]quinazoline (PubChem CID 167194570) has the molecular formula C24H32N6O3S and a molecular weight of 484.63 g/mol. Its IUPAC name is 2-[[4-(dimethylamino)cyclohexyl]amino]-8-ethyl-6-[2-methoxy-6-(sulfinoamino)-3-pyridinyl]quinazoline.
| Compound Name | 2-[[4-(dimethylamino)cyclohexyl]amino]-8-ethyl-6-[2-methoxy-6-(sulfinoamino)-3-pyridinyl]quinazoline |
|---|---|
| PubChem CID | 167194570 |
| Molecular Formula | C24H32N6O3S |
| Molecular Weight | 484.63 g/mol |
| Exact Mass | 484.23 |
| IUPAC Name | 2-[[4-(dimethylamino)cyclohexyl]amino]-8-ethyl-6-[2-methoxy-6-(sulfinoamino)-3-pyridinyl]quinazoline |
| SMILES | CCc1cc(-c2ccc(NS(=O)O)nc2OC)cc2cnc(NC3CCC(N(C)C)CC3)nc12 |
| InChI | InChI=1S/C24H32N6O3S/c1-5-15-12-16(20-10-11-21(29-34(31)32)27-23(20)33-4)13-17-14-25-24(28-22(15)17)26-18-6-8-19(9-7-18)30(2)3/h10-14,18-19H,5-9H2,1-4H3,(H,27,29)(H,31,32)(H,25,26,28) |
| InChIKey | KZFOURGDUZJLAU-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 112.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.63 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|