C11H17N3O2 — CID 167195666
(2,4-dimethyl-3H-pyridazin-5-yl)-morpholin-4-ylmethanone (PubChem CID 167195666) has the molecular formula C11H17N3O2 and a molecular weight of 223.28 g/mol. Its IUPAC name is (2,4-dimethyl-3H-pyridazin-5-yl)-morpholin-4-ylmethanone.
| Compound Name | (2,4-dimethyl-3H-pyridazin-5-yl)-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 167195666 |
| Molecular Formula | C11H17N3O2 |
| Molecular Weight | 223.28 g/mol |
| Exact Mass | 223.13 |
| IUPAC Name | (2,4-dimethyl-3H-pyridazin-5-yl)-morpholin-4-ylmethanone |
| SMILES | CC1=C(C(=O)N2CCOCC2)C=NN(C)C1 |
| InChI | InChI=1S/C11H17N3O2/c1-9-8-13(2)12-7-10(9)11(15)14-3-5-16-6-4-14/h7H,3-6,8H2,1-2H3 |
| InChIKey | KMVSZVOKNJRUOD-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 45.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.28 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |