C53H45N3 — CID 167196515
2-(4-cyclohexa-2,4-dien-1-ylphenyl)-6-[11,11-dimethyl-2-[4-(6-methylcyclohexa-2,4-dien-1-yl)phenyl]benzo[b]fluoren-5-yl]-4-phenyl-1,4-dihydro-1,3,5-triazine (PubChem CID 167196515) has the molecular formula C53H45N3 and a molecular weight of 723.96 g/mol. Its IUPAC name is 2-(4-cyclohexa-2,4-dien-1-ylphenyl)-6-[11,11-dimethyl-2-[4-(6-methylcyclohexa-2,4-dien-1-yl)phenyl]benzo[b]fluoren-5-yl]-4-phenyl-1,4-dihydro-1,3,5-triazine.
| Compound Name | 2-(4-cyclohexa-2,4-dien-1-ylphenyl)-6-[11,11-dimethyl-2-[4-(6-methylcyclohexa-2,4-dien-1-yl)phenyl]benzo[b]fluoren-5-yl]-4-phenyl-1,4-dihydro-1,3,5-triazine |
|---|---|
| PubChem CID | 167196515 |
| Molecular Formula | C53H45N3 |
| Molecular Weight | 723.96 g/mol |
| Exact Mass | 723.36 |
| IUPAC Name | 2-(4-cyclohexa-2,4-dien-1-ylphenyl)-6-[11,11-dimethyl-2-[4-(6-methylcyclohexa-2,4-dien-1-yl)phenyl]benzo[b]fluoren-5-yl]-4-phenyl-1,4-dihydro-1,3,5-triazine |
| SMILES | CC1C=CC=CC1c1ccc(-c2ccc3c(c2)C(C)(C)c2cc4ccccc4c(C4=NC(c5ccccc5)N=C(c5ccc(C6C=CC=CC6)cc5)N4)c2-3)cc1 |
| InChI | InChI=1S/C53H45N3/c1-34-14-10-12-20-43(34)38-26-22-37(23-27-38)41-30-31-45-46(32-41)53(2,3)47-33-42-19-11-13-21-44(42)49(48(45)47)52-55-50(39-17-8-5-9-18-39)54-51(56-52)40-28-24-36(25-29-40)35-15-6-4-7-16-35/h4-15,17-35,43,50H,16H2,1-3H3,(H,54,55,56) |
| InChIKey | HJWWRLDWKNMOFA-UHFFFAOYSA-N |
| XLogP | 12.75 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 723.96 |
| LogP ≤ 5 | 12.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |