C19H12F6N4O2 — CID 167196702
1-[5-fluoro-6-[2-oxo-1-(2,2,3,3,3-pentafluoropropyl)-4H-pyrido[3,4-d][1,3]oxazin-6-yl]-3-pyridinyl]cyclopropane-1-carbonitrile (PubChem CID 167196702) has the molecular formula C19H12F6N4O2 and a molecular weight of 442.32 g/mol. Its IUPAC name is 1-[5-fluoro-6-[2-oxo-1-(2,2,3,3,3-pentafluoropropyl)-4H-pyrido[3,4-d][1,3]oxazin-6-yl]-3-pyridinyl]cyclopropane-1-carbonitrile.
| Compound Name | 1-[5-fluoro-6-[2-oxo-1-(2,2,3,3,3-pentafluoropropyl)-4H-pyrido[3,4-d][1,3]oxazin-6-yl]-3-pyridinyl]cyclopropane-1-carbonitrile |
|---|---|
| PubChem CID | 167196702 |
| Molecular Formula | C19H12F6N4O2 |
| Molecular Weight | 442.32 g/mol |
| Exact Mass | 442.09 |
| IUPAC Name | 1-[5-fluoro-6-[2-oxo-1-(2,2,3,3,3-pentafluoropropyl)-4H-pyrido[3,4-d][1,3]oxazin-6-yl]-3-pyridinyl]cyclopropane-1-carbonitrile |
| SMILES | N#CC1(c2cnc(-c3cc4c(cn3)N(CC(F)(F)C(F)(F)F)C(=O)OC4)c(F)c2)CC1 |
| InChI | InChI=1S/C19H12F6N4O2/c20-12-4-11(17(8-26)1-2-17)5-28-15(12)13-3-10-7-31-16(30)29(14(10)6-27-13)9-18(21,22)19(23,24)25/h3-6H,1-2,7,9H2 |
| InChIKey | VFYKWZZIIVRIEW-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 79.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.32 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|