C16H12F6N3O3+ — CID 167196712
6-(3-fluoro-1-methoxypyridin-1-ium-2-yl)-1-(2,2,3,3,3-pentafluoropropyl)-4H-pyrido[3,4-d][1,3]oxazin-2-one (PubChem CID 167196712) has the molecular formula C16H12F6N3O3+ and a molecular weight of 408.28 g/mol. Its IUPAC name is 6-(3-fluoro-1-methoxypyridin-1-ium-2-yl)-1-(2,2,3,3,3-pentafluoropropyl)-4H-pyrido[3,4-d][1,3]oxazin-2-one.
| Compound Name | 6-(3-fluoro-1-methoxypyridin-1-ium-2-yl)-1-(2,2,3,3,3-pentafluoropropyl)-4H-pyrido[3,4-d][1,3]oxazin-2-one |
|---|---|
| PubChem CID | 167196712 |
| Molecular Formula | C16H12F6N3O3+ |
| Molecular Weight | 408.28 g/mol |
| Exact Mass | 408.08 |
| IUPAC Name | 6-(3-fluoro-1-methoxypyridin-1-ium-2-yl)-1-(2,2,3,3,3-pentafluoropropyl)-4H-pyrido[3,4-d][1,3]oxazin-2-one |
| SMILES | CO[n+]1cccc(F)c1-c1cc2c(cn1)N(CC(F)(F)C(F)(F)F)C(=O)OC2 |
| InChI | InChI=1S/C16H12F6N3O3/c1-27-25-4-2-3-10(17)13(25)11-5-9-7-28-14(26)24(12(9)6-23-11)8-15(18,19)16(20,21)22/h2-6H,7-8H2,1H3/q+1 |
| InChIKey | WBAHADCCIBGUAX-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 55.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.28 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|