About 4-[5-[3-methyl-6-(4-propan-2-ylsulfinylphenyl)pyrazin-2-yl]-1,3,4-oxadiazol-2-yl]aniline
4-[5-[3-methyl-6-(4-propan-2-ylsulfinylphenyl)pyrazin-2-yl]-1,3,4-oxadiazol-2-yl]aniline (PubChem CID 167196720) has the molecular formula C22H21N5O2S
and a molecular weight of 419.51 g/mol. Its IUPAC name is 4-[5-[3-methyl-6-(4-propan-2-ylsulfinylphenyl)pyrazin-2-yl]-1,3,4-oxadiazol-2-yl]aniline.
Molecular Properties
| Compound Name | 4-[5-[3-methyl-6-(4-propan-2-ylsulfinylphenyl)pyrazin-2-yl]-1,3,4-oxadiazol-2-yl]aniline |
| PubChem CID | 167196720 |
| Molecular Formula | C22H21N5O2S |
| Molecular Weight | 419.51 g/mol |
| Exact Mass | 419.14 |
| IUPAC Name | 4-[5-[3-methyl-6-(4-propan-2-ylsulfinylphenyl)pyrazin-2-yl]-1,3,4-oxadiazol-2-yl]aniline |
| SMILES | Cc1ncc(-c2ccc(S(=O)C(C)C)cc2)nc1-c1nnc(-c2ccc(N)cc2)o1 |
| InChI | InChI=1S/C22H21N5O2S/c1-13(2)30(28)18-10-6-15(7-11-18)19-12-24-14(3)20(25-19)22-27-26-21(29-22)16-4-8-17(23)9-5-16/h4-13H,23H2,1-3H3 |
| InChIKey | SPOXIWSMXDQIDE-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 107.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 419.51 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-[5-[3-methyl-6-(4-propan-2-ylsulfinylphenyl)pyrazin-2-yl]-1,3,4-oxadiazol-2-yl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[5-[3-methyl-6-(4-propan-2-ylsulfinylphenyl)pyrazin-2-yl]-1,3,4-oxadiazol-2-yl]aniline?
The IUPAC name of 4-[5-[3-methyl-6-(4-propan-2-ylsulfinylphenyl)pyrazin-2-yl]-1,3,4-oxadiazol-2-yl]aniline (CID 167196720) is 4-[5-[3-methyl-6-(4-propan-2-ylsulfinylphenyl)pyrazin-2-yl]-1,3,4-oxadiazol-2-yl]aniline.
What is the SMILES notation for 4-[5-[3-methyl-6-(4-propan-2-ylsulfinylphenyl)pyrazin-2-yl]-1,3,4-oxadiazol-2-yl]aniline?
The canonical SMILES for 4-[5-[3-methyl-6-(4-propan-2-ylsulfinylphenyl)pyrazin-2-yl]-1,3,4-oxadiazol-2-yl]aniline is Cc1ncc(-c2ccc(S(=O)C(C)C)cc2)nc1-c1nnc(-c2ccc(N)cc2)o1.
What is the InChIKey of 4-[5-[3-methyl-6-(4-propan-2-ylsulfinylphenyl)pyrazin-2-yl]-1,3,4-oxadiazol-2-yl]aniline?
The InChIKey is SPOXIWSMXDQIDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H21N5O2S/c1-13(2)30(28)18-10-6-15(7-11-18)19-12-24-14(3)20(25-19)22-27-26-21(29-22)16-4-8-17(23)9-5-16/h4-13H,23H2,1-3H3.
What are the key properties of 4-[5-[3-methyl-6-(4-propan-2-ylsulfinylphenyl)pyrazin-2-yl]-1,3,4-oxadiazol-2-yl]aniline?
4-[5-[3-methyl-6-(4-propan-2-ylsulfinylphenyl)pyrazin-2-yl]-1,3,4-oxadiazol-2-yl]aniline has a molecular weight of 419.51 g/mol, XLogP of 4.27, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[5-[3-methyl-6-(4-propan-2-ylsulfinylphenyl)pyrazin-2-yl]-1,3,4-oxadiazol-2-yl]aniline is sourced from PubChem (CID 167196720), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).