C20H30O4 — CID 16719737
(6Z,9R,10E,12S,13R)-9,12-dihydroxy-13-[(2Z,5Z)-octa-2,5-dienyl]-1-oxacyclotrideca-6,10-dien-2-one (PubChem CID 16719737) has the molecular formula C20H30O4 and a molecular weight of 334.46 g/mol. Its IUPAC name is (6Z,9R,10E,12S,13R)-9,12-dihydroxy-13-[(2Z,5Z)-octa-2,5-dienyl]-1-oxacyclotrideca-6,10-dien-2-one.
| Compound Name | (6Z,9R,10E,12S,13R)-9,12-dihydroxy-13-[(2Z,5Z)-octa-2,5-dienyl]-1-oxacyclotrideca-6,10-dien-2-one |
|---|---|
| PubChem CID | 16719737 |
| Molecular Formula | C20H30O4 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | (6Z,9R,10E,12S,13R)-9,12-dihydroxy-13-[(2Z,5Z)-octa-2,5-dienyl]-1-oxacyclotrideca-6,10-dien-2-one |
| SMILES | CC/C=C\C/C=C\C[C@H]1OC(=O)CCC/C=C\C[C@@H](O)/C=C/[C@@H]1O |
| InChI | InChI=1S/C20H30O4/c1-2-3-4-5-6-10-13-19-18(22)16-15-17(21)12-9-7-8-11-14-20(23)24-19/h3-4,6-7,9-10,15-19,21-22H,2,5,8,11-14H2,1H3/b4-3-,9-7-,10-6-,16-15+/t17-,18+,19-/m1/s1 |
| InChIKey | STBQZNSMPFUZOI-POQSKWFZSA-N |
| XLogP | 3.61 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|