About octyl 3-(2,4-dihydroxyphenyl)propanoate
octyl 3-(2,4-dihydroxyphenyl)propanoate (PubChem CID 16719753) has the molecular formula C17H26O4
and a molecular weight of 294.39 g/mol. Its IUPAC name is octyl 3-(2,4-dihydroxyphenyl)propanoate.
Molecular Properties
| Compound Name | octyl 3-(2,4-dihydroxyphenyl)propanoate |
| PubChem CID | 16719753 |
| Molecular Formula | C17H26O4 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | octyl 3-(2,4-dihydroxyphenyl)propanoate |
| SMILES | CCCCCCCCOC(=O)CCc1ccc(O)cc1O |
| InChI | InChI=1S/C17H26O4/c1-2-3-4-5-6-7-12-21-17(20)11-9-14-8-10-15(18)13-16(14)19/h8,10,13,18-19H,2-7,9,11-12H2,1H3 |
| InChIKey | JBDJEFWYTRPAHZ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze octyl 3-(2,4-dihydroxyphenyl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of octyl 3-(2,4-dihydroxyphenyl)propanoate?
The IUPAC name of octyl 3-(2,4-dihydroxyphenyl)propanoate (CID 16719753) is octyl 3-(2,4-dihydroxyphenyl)propanoate.
What is the SMILES notation for octyl 3-(2,4-dihydroxyphenyl)propanoate?
The canonical SMILES for octyl 3-(2,4-dihydroxyphenyl)propanoate is CCCCCCCCOC(=O)CCc1ccc(O)cc1O.
What is the InChIKey of octyl 3-(2,4-dihydroxyphenyl)propanoate?
The InChIKey is JBDJEFWYTRPAHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26O4/c1-2-3-4-5-6-7-12-21-17(20)11-9-14-8-10-15(18)13-16(14)19/h8,10,13,18-19H,2-7,9,11-12H2,1H3.
What are the key properties of octyl 3-(2,4-dihydroxyphenyl)propanoate?
octyl 3-(2,4-dihydroxyphenyl)propanoate has a molecular weight of 294.39 g/mol, XLogP of 3.93, 10 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for octyl 3-(2,4-dihydroxyphenyl)propanoate is sourced from PubChem (CID 16719753), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).