C18H17ClF3NOS — CID 167199746
1-(3-chlorophenyl)-N-[4-(trifluoromethoxy)phenyl]sulfanylcyclopentan-1-amine (PubChem CID 167199746) has the molecular formula C18H17ClF3NOS and a molecular weight of 387.85 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-N-[4-(trifluoromethoxy)phenyl]sulfanylcyclopentan-1-amine.
| Compound Name | 1-(3-chlorophenyl)-N-[4-(trifluoromethoxy)phenyl]sulfanylcyclopentan-1-amine |
|---|---|
| PubChem CID | 167199746 |
| Molecular Formula | C18H17ClF3NOS |
| Molecular Weight | 387.85 g/mol |
| Exact Mass | 387.07 |
| IUPAC Name | 1-(3-chlorophenyl)-N-[4-(trifluoromethoxy)phenyl]sulfanylcyclopentan-1-amine |
| SMILES | FC(F)(F)Oc1ccc(SNC2(c3cccc(Cl)c3)CCCC2)cc1 |
| InChI | InChI=1S/C18H17ClF3NOS/c19-14-5-3-4-13(12-14)17(10-1-2-11-17)23-25-16-8-6-15(7-9-16)24-18(20,21)22/h3-9,12,23H,1-2,10-11H2 |
| InChIKey | SWEWUEPHCMIWCJ-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.85 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|