C16H28F2N2 — CID 167199887
6-[(3E,5R)-4,5-difluoro-6-methylhepta-1,3-dien-2-yl]-1-methyl-6-propyl-1,3-diazinane (PubChem CID 167199887) has the molecular formula C16H28F2N2 and a molecular weight of 286.41 g/mol. Its IUPAC name is 6-[(3E,5R)-4,5-difluoro-6-methylhepta-1,3-dien-2-yl]-1-methyl-6-propyl-1,3-diazinane.
| Compound Name | 6-[(3E,5R)-4,5-difluoro-6-methylhepta-1,3-dien-2-yl]-1-methyl-6-propyl-1,3-diazinane |
|---|---|
| PubChem CID | 167199887 |
| Molecular Formula | C16H28F2N2 |
| Molecular Weight | 286.41 g/mol |
| Exact Mass | 286.22 |
| IUPAC Name | 6-[(3E,5R)-4,5-difluoro-6-methylhepta-1,3-dien-2-yl]-1-methyl-6-propyl-1,3-diazinane |
| SMILES | C=C(/C=C(/F)[C@H](F)C(C)C)C1(CCC)CCNCN1C |
| InChI | InChI=1S/C16H28F2N2/c1-6-7-16(8-9-19-11-20(16)5)13(4)10-14(17)15(18)12(2)3/h10,12,15,19H,4,6-9,11H2,1-3,5H3/b14-10+/t15-,16?/m1/s1 |
| InChIKey | RMUHOARCXAIHOG-LDEOMYFHSA-N |
| XLogP | 3.81 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.41 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|