C27H41NO — CID 167199891
2-methyl-N-[2-[[(1E)-5-[(6Z)-octa-1,3,6-trien-2-yl]oxycycloocta-1,3,6-trien-1-yl]methyl]prop-2-enyl]hexan-1-amine (PubChem CID 167199891) has the molecular formula C27H41NO and a molecular weight of 395.63 g/mol. Its IUPAC name is 2-methyl-N-[2-[[(1E)-5-[(6Z)-octa-1,3,6-trien-2-yl]oxycycloocta-1,3,6-trien-1-yl]methyl]prop-2-enyl]hexan-1-amine.
| Compound Name | 2-methyl-N-[2-[[(1E)-5-[(6Z)-octa-1,3,6-trien-2-yl]oxycycloocta-1,3,6-trien-1-yl]methyl]prop-2-enyl]hexan-1-amine |
|---|---|
| PubChem CID | 167199891 |
| Molecular Formula | C27H41NO |
| Molecular Weight | 395.63 g/mol |
| Exact Mass | 395.32 |
| IUPAC Name | 2-methyl-N-[2-[[(1E)-5-[(6Z)-octa-1,3,6-trien-2-yl]oxycycloocta-1,3,6-trien-1-yl]methyl]prop-2-enyl]hexan-1-amine |
| SMILES | C=C(CNCC(C)CCCC)C/C1=C/C=CC(OC(=C)C=CC/C=C\C)C=CC1 |
| InChI | InChI=1S/C27H41NO/c1-6-8-10-11-15-25(5)29-27-18-12-16-26(17-13-19-27)20-24(4)22-28-21-23(3)14-9-7-2/h6,8,11-13,15-16,18-19,23,27-28H,4-5,7,9-10,14,17,20-22H2,1-3H3/b8-6-,15-11?,18-12?,19-13?,26-16+ |
| InChIKey | FQUQZZSIUHKKSN-QDBFBPTHSA-N |
| XLogP | 7.21 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.63 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|