About 3-[(2Z)-4-fluoropenta-2,4-dienyl]-3-methylpyrrolidine
3-[(2Z)-4-fluoropenta-2,4-dienyl]-3-methylpyrrolidine (PubChem CID 167199904) has the molecular formula C10H16FN
and a molecular weight of 169.24 g/mol. Its IUPAC name is 3-[(2Z)-4-fluoropenta-2,4-dienyl]-3-methylpyrrolidine.
Molecular Properties
| Compound Name | 3-[(2Z)-4-fluoropenta-2,4-dienyl]-3-methylpyrrolidine |
| PubChem CID | 167199904 |
| Molecular Formula | C10H16FN |
| Molecular Weight | 169.24 g/mol |
| Exact Mass | 169.13 |
| IUPAC Name | 3-[(2Z)-4-fluoropenta-2,4-dienyl]-3-methylpyrrolidine |
| SMILES | C=C(F)/C=C\CC1(C)CCNC1 |
| InChI | InChI=1S/C10H16FN/c1-9(11)4-3-5-10(2)6-7-12-8-10/h3-4,12H,1,5-8H2,2H3/b4-3- |
| InChIKey | BANSBPXNCXRVNR-ARJAWSKDSA-N |
| XLogP | 2.42 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.24 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 3-[(2Z)-4-fluoropenta-2,4-dienyl]-3-methylpyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2Z)-4-fluoropenta-2,4-dienyl]-3-methylpyrrolidine?
The IUPAC name of 3-[(2Z)-4-fluoropenta-2,4-dienyl]-3-methylpyrrolidine (CID 167199904) is 3-[(2Z)-4-fluoropenta-2,4-dienyl]-3-methylpyrrolidine.
What is the SMILES notation for 3-[(2Z)-4-fluoropenta-2,4-dienyl]-3-methylpyrrolidine?
The canonical SMILES for 3-[(2Z)-4-fluoropenta-2,4-dienyl]-3-methylpyrrolidine is C=C(F)/C=C\CC1(C)CCNC1.
What is the InChIKey of 3-[(2Z)-4-fluoropenta-2,4-dienyl]-3-methylpyrrolidine?
The InChIKey is BANSBPXNCXRVNR-ARJAWSKDSA-N. The full InChI is InChI=1S/C10H16FN/c1-9(11)4-3-5-10(2)6-7-12-8-10/h3-4,12H,1,5-8H2,2H3/b4-3-.
What are the key properties of 3-[(2Z)-4-fluoropenta-2,4-dienyl]-3-methylpyrrolidine?
3-[(2Z)-4-fluoropenta-2,4-dienyl]-3-methylpyrrolidine has a molecular weight of 169.24 g/mol, XLogP of 2.42, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2Z)-4-fluoropenta-2,4-dienyl]-3-methylpyrrolidine is sourced from PubChem (CID 167199904), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).