C23H36FN3S2 — CID 167199942
1-N-tert-butyl-3-N-[4-(2-fluoro-2-methylpropyl)phenyl]sulfanyl-3-(1,3-thiazol-2-yl)hexane-1,3-diamine (PubChem CID 167199942) has the molecular formula C23H36FN3S2 and a molecular weight of 437.69 g/mol. Its IUPAC name is 1-N-tert-butyl-3-N-[4-(2-fluoro-2-methylpropyl)phenyl]sulfanyl-3-(1,3-thiazol-2-yl)hexane-1,3-diamine.
| Compound Name | 1-N-tert-butyl-3-N-[4-(2-fluoro-2-methylpropyl)phenyl]sulfanyl-3-(1,3-thiazol-2-yl)hexane-1,3-diamine |
|---|---|
| PubChem CID | 167199942 |
| Molecular Formula | C23H36FN3S2 |
| Molecular Weight | 437.69 g/mol |
| Exact Mass | 437.23 |
| IUPAC Name | 1-N-tert-butyl-3-N-[4-(2-fluoro-2-methylpropyl)phenyl]sulfanyl-3-(1,3-thiazol-2-yl)hexane-1,3-diamine |
| SMILES | CCCC(CCNC(C)(C)C)(NSc1ccc(CC(C)(C)F)cc1)c1nccs1 |
| InChI | InChI=1S/C23H36FN3S2/c1-7-12-23(20-25-15-16-28-20,13-14-26-21(2,3)4)27-29-19-10-8-18(9-11-19)17-22(5,6)24/h8-11,15-16,26-27H,7,12-14,17H2,1-6H3 |
| InChIKey | ZCANBBCLLSQHJB-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.69 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|