About N-[(Z,2S)-2-fluoro-2,3-dimethylhex-3-enyl]ethanimine
N-[(Z,2S)-2-fluoro-2,3-dimethylhex-3-enyl]ethanimine (PubChem CID 167199959) has the molecular formula C10H18FN
and a molecular weight of 171.26 g/mol. Its IUPAC name is N-[(Z,2S)-2-fluoro-2,3-dimethylhex-3-enyl]ethanimine.
Molecular Properties
| Compound Name | N-[(Z,2S)-2-fluoro-2,3-dimethylhex-3-enyl]ethanimine |
| PubChem CID | 167199959 |
| Molecular Formula | C10H18FN |
| Molecular Weight | 171.26 g/mol |
| Exact Mass | 171.14 |
| IUPAC Name | N-[(Z,2S)-2-fluoro-2,3-dimethylhex-3-enyl]ethanimine |
| SMILES | C/C=N/C[C@@](C)(F)/C(C)=C\CC |
| InChI | InChI=1S/C10H18FN/c1-5-7-9(3)10(4,11)8-12-6-2/h6-7H,5,8H2,1-4H3/b9-7-,12-6+/t10-/m1/s1 |
| InChIKey | GFEBQPGRHZRZKV-WVIYDONDSA-N |
| XLogP | 3.16 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.26 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-[(Z,2S)-2-fluoro-2,3-dimethylhex-3-enyl]ethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(Z,2S)-2-fluoro-2,3-dimethylhex-3-enyl]ethanimine?
The IUPAC name of N-[(Z,2S)-2-fluoro-2,3-dimethylhex-3-enyl]ethanimine (CID 167199959) is N-[(Z,2S)-2-fluoro-2,3-dimethylhex-3-enyl]ethanimine.
What is the SMILES notation for N-[(Z,2S)-2-fluoro-2,3-dimethylhex-3-enyl]ethanimine?
The canonical SMILES for N-[(Z,2S)-2-fluoro-2,3-dimethylhex-3-enyl]ethanimine is C/C=N/C[C@@](C)(F)/C(C)=C\CC.
What is the InChIKey of N-[(Z,2S)-2-fluoro-2,3-dimethylhex-3-enyl]ethanimine?
The InChIKey is GFEBQPGRHZRZKV-WVIYDONDSA-N. The full InChI is InChI=1S/C10H18FN/c1-5-7-9(3)10(4,11)8-12-6-2/h6-7H,5,8H2,1-4H3/b9-7-,12-6+/t10-/m1/s1.
What are the key properties of N-[(Z,2S)-2-fluoro-2,3-dimethylhex-3-enyl]ethanimine?
N-[(Z,2S)-2-fluoro-2,3-dimethylhex-3-enyl]ethanimine has a molecular weight of 171.26 g/mol, XLogP of 3.16, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(Z,2S)-2-fluoro-2,3-dimethylhex-3-enyl]ethanimine is sourced from PubChem (CID 167199959), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).