C12H21F2N — CID 167200001
(2Z,4Z)-5-ethyl-2,3-difluoro-N-methylnona-2,4-dien-4-amine (PubChem CID 167200001) has the molecular formula C12H21F2N and a molecular weight of 217.30 g/mol. Its IUPAC name is (2Z,4Z)-5-ethyl-2,3-difluoro-N-methylnona-2,4-dien-4-amine.
| Compound Name | (2Z,4Z)-5-ethyl-2,3-difluoro-N-methylnona-2,4-dien-4-amine |
|---|---|
| PubChem CID | 167200001 |
| Molecular Formula | C12H21F2N |
| Molecular Weight | 217.30 g/mol |
| Exact Mass | 217.16 |
| IUPAC Name | (2Z,4Z)-5-ethyl-2,3-difluoro-N-methylnona-2,4-dien-4-amine |
| SMILES | CCCC/C(CC)=C(NC)/C(F)=C(\C)F |
| InChI | InChI=1S/C12H21F2N/c1-5-7-8-10(6-2)12(15-4)11(14)9(3)13/h15H,5-8H2,1-4H3/b11-9-,12-10- |
| InChIKey | QYNULXPSFONTJG-HWAYABPNSA-N |
| XLogP | 4.23 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.30 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|