C13H21NO — CID 167200070
1-[(4Z,6E)-7-methoxyocta-1,4,6-trien-3-yl]pyrrolidine (PubChem CID 167200070) has the molecular formula C13H21NO and a molecular weight of 207.32 g/mol. Its IUPAC name is 1-[(4Z,6E)-7-methoxyocta-1,4,6-trien-3-yl]pyrrolidine.
| Compound Name | 1-[(4Z,6E)-7-methoxyocta-1,4,6-trien-3-yl]pyrrolidine |
|---|---|
| PubChem CID | 167200070 |
| Molecular Formula | C13H21NO |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.16 |
| IUPAC Name | 1-[(4Z,6E)-7-methoxyocta-1,4,6-trien-3-yl]pyrrolidine |
| SMILES | C=CC(/C=C\C=C(/C)OC)N1CCCC1 |
| InChI | InChI=1S/C13H21NO/c1-4-13(14-10-5-6-11-14)9-7-8-12(2)15-3/h4,7-9,13H,1,5-6,10-11H2,2-3H3/b9-7-,12-8+ |
| InChIKey | DBTVSGLQVQVEQD-ZUQSVMQASA-N |
| XLogP | 2.74 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|