About 2-butan-2-yl-4-chloro-5-methyl-4,5-dihydrothiepine
2-butan-2-yl-4-chloro-5-methyl-4,5-dihydrothiepine (PubChem CID 167200120) has the molecular formula C11H17ClS
and a molecular weight of 216.78 g/mol. Its IUPAC name is 2-butan-2-yl-4-chloro-5-methyl-4,5-dihydrothiepine.
Molecular Properties
| Compound Name | 2-butan-2-yl-4-chloro-5-methyl-4,5-dihydrothiepine |
| PubChem CID | 167200120 |
| Molecular Formula | C11H17ClS |
| Molecular Weight | 216.78 g/mol |
| Exact Mass | 216.07 |
| IUPAC Name | 2-butan-2-yl-4-chloro-5-methyl-4,5-dihydrothiepine |
| SMILES | CCC(C)C1=CC(Cl)C(C)C=CS1 |
| InChI | InChI=1S/C11H17ClS/c1-4-8(2)11-7-10(12)9(3)5-6-13-11/h5-10H,4H2,1-3H3 |
| InChIKey | MJRQXJSPXOBMAE-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.78 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-butan-2-yl-4-chloro-5-methyl-4,5-dihydrothiepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butan-2-yl-4-chloro-5-methyl-4,5-dihydrothiepine?
The IUPAC name of 2-butan-2-yl-4-chloro-5-methyl-4,5-dihydrothiepine (CID 167200120) is 2-butan-2-yl-4-chloro-5-methyl-4,5-dihydrothiepine.
What is the SMILES notation for 2-butan-2-yl-4-chloro-5-methyl-4,5-dihydrothiepine?
The canonical SMILES for 2-butan-2-yl-4-chloro-5-methyl-4,5-dihydrothiepine is CCC(C)C1=CC(Cl)C(C)C=CS1.
What is the InChIKey of 2-butan-2-yl-4-chloro-5-methyl-4,5-dihydrothiepine?
The InChIKey is MJRQXJSPXOBMAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17ClS/c1-4-8(2)11-7-10(12)9(3)5-6-13-11/h5-10H,4H2,1-3H3.
What are the key properties of 2-butan-2-yl-4-chloro-5-methyl-4,5-dihydrothiepine?
2-butan-2-yl-4-chloro-5-methyl-4,5-dihydrothiepine has a molecular weight of 216.78 g/mol, XLogP of 4.42, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butan-2-yl-4-chloro-5-methyl-4,5-dihydrothiepine is sourced from PubChem (CID 167200120), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).