C52H56N4NiO2 — CID 16720016
(E,3Z)-3-[5,15-bis(3,5-ditert-butylphenyl)porphyrin-24-id-2-ylidene]-1-methoxyprop-1-en-1-olate;nickel(2+) (PubChem CID 16720016) has the molecular formula C52H56N4NiO2 and a molecular weight of 827.74 g/mol. Its IUPAC name is (E,3Z)-3-[5,15-bis(3,5-ditert-butylphenyl)porphyrin-24-id-2-ylidene]-1-methoxyprop-1-en-1-olate;nickel(2+).
| Compound Name | (E,3Z)-3-[5,15-bis(3,5-ditert-butylphenyl)porphyrin-24-id-2-ylidene]-1-methoxyprop-1-en-1-olate;nickel(2+) |
|---|---|
| PubChem CID | 16720016 |
| Molecular Formula | C52H56N4NiO2 |
| Molecular Weight | 827.74 g/mol |
| Exact Mass | 826.38 |
| IUPAC Name | (E,3Z)-3-[5,15-bis(3,5-ditert-butylphenyl)porphyrin-24-id-2-ylidene]-1-methoxyprop-1-en-1-olate;nickel(2+) |
| SMILES | CO/C([O-])=C/C=C1/C=C2N=C1/C=c1/cc/c([n-]1)=C(\c1cc(C(C)(C)C)cc(C(C)(C)C)c1)C1=N/C(=C\C3=N/C(=C\2c2cc(C(C)(C)C)cc(C(C)(C)C)c2)C=C3)C=C1.[Ni+2] |
| InChI | InChI=1S/C52H57N4O2.Ni/c1-49(2,3)34-22-32(23-35(27-34)50(4,5)6)47-41-18-15-38(53-41)29-39-16-19-43(54-39)48(33-24-36(51(7,8)9)28-37(25-33)52(10,11)12)45-26-31(14-21-46(57)58-13)44(56-45)30-40-17-20-42(47)55-40;/h14-30H,1-13H3,(H-,53,54,55,56,57);/q-1;+2/p-1/b38-29-,39-29-,40-30-,44-30-,47-41-,47-42-,48-43-,48-45-; |
| InChIKey | YPVHWDWNIHVIJC-GUHOKWCUSA-M |
| XLogP | 9.25 |
| TPSA | 83.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 827.74 |
| LogP ≤ 5 | 9.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|