C15H25ClFN — CID 167200213
3-[(6Z,8E)-8-chloroundeca-6,8-dien-5-yl]-4-fluoropyrrolidine (PubChem CID 167200213) has the molecular formula C15H25ClFN and a molecular weight of 273.82 g/mol. Its IUPAC name is 3-[(6Z,8E)-8-chloroundeca-6,8-dien-5-yl]-4-fluoropyrrolidine.
| Compound Name | 3-[(6Z,8E)-8-chloroundeca-6,8-dien-5-yl]-4-fluoropyrrolidine |
|---|---|
| PubChem CID | 167200213 |
| Molecular Formula | C15H25ClFN |
| Molecular Weight | 273.82 g/mol |
| Exact Mass | 273.17 |
| IUPAC Name | 3-[(6Z,8E)-8-chloroundeca-6,8-dien-5-yl]-4-fluoropyrrolidine |
| SMILES | CC/C=C(Cl)\C=C/C(CCCC)C1CNCC1F |
| InChI | InChI=1S/C15H25ClFN/c1-3-5-7-12(8-9-13(16)6-4-2)14-10-18-11-15(14)17/h6,8-9,12,14-15,18H,3-5,7,10-11H2,1-2H3/b9-8-,13-6+ |
| InChIKey | LCJKBNLJJNRXSI-GFBXJKNCSA-N |
| XLogP | 4.44 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.82 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|