C18H22FN5O2 — CID 167200231
3-[5-[(7-fluoroquinazolin-4-yl)amino]pentyl]-5,5-dimethylimidazolidine-2,4-dione (PubChem CID 167200231) has the molecular formula C18H22FN5O2 and a molecular weight of 359.41 g/mol. Its IUPAC name is 3-[5-[(7-fluoroquinazolin-4-yl)amino]pentyl]-5,5-dimethylimidazolidine-2,4-dione.
| Compound Name | 3-[5-[(7-fluoroquinazolin-4-yl)amino]pentyl]-5,5-dimethylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 167200231 |
| Molecular Formula | C18H22FN5O2 |
| Molecular Weight | 359.41 g/mol |
| Exact Mass | 359.18 |
| IUPAC Name | 3-[5-[(7-fluoroquinazolin-4-yl)amino]pentyl]-5,5-dimethylimidazolidine-2,4-dione |
| SMILES | CC1(C)NC(=O)N(CCCCCNc2ncnc3cc(F)ccc23)C1=O |
| InChI | InChI=1S/C18H22FN5O2/c1-18(2)16(25)24(17(26)23-18)9-5-3-4-8-20-15-13-7-6-12(19)10-14(13)21-11-22-15/h6-7,10-11H,3-5,8-9H2,1-2H3,(H,23,26)(H,20,21,22) |
| InChIKey | NXYPUGRNQUPBOH-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.41 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|