C8H11Cl2NO2 — CID 167200783
1,4-dichloro-3,3,5-trimethylpiperidine-2,6-dione (PubChem CID 167200783) has the molecular formula C8H11Cl2NO2 and a molecular weight of 224.09 g/mol. Its IUPAC name is 1,4-dichloro-3,3,5-trimethylpiperidine-2,6-dione.
| Compound Name | 1,4-dichloro-3,3,5-trimethylpiperidine-2,6-dione |
|---|---|
| PubChem CID | 167200783 |
| Molecular Formula | C8H11Cl2NO2 |
| Molecular Weight | 224.09 g/mol |
| Exact Mass | 223.02 |
| IUPAC Name | 1,4-dichloro-3,3,5-trimethylpiperidine-2,6-dione |
| SMILES | CC1C(=O)N(Cl)C(=O)C(C)(C)C1Cl |
| InChI | InChI=1S/C8H11Cl2NO2/c1-4-5(9)8(2,3)7(13)11(10)6(4)12/h4-5H,1-3H3 |
| InChIKey | HDQQPQXBUDRAJH-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.09 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|