C36H37Cl2N5O2 — CID 167200883
N-[2-[[4-[2-chloro-3-[1-[[2-chloro-5-methoxy-4-(pyrrolidin-1-ylmethyl)phenyl]methyl]indazol-4-yl]phenyl]phenyl]methylamino]ethyl]formamide (PubChem CID 167200883) has the molecular formula C36H37Cl2N5O2 and a molecular weight of 642.63 g/mol. Its IUPAC name is N-[2-[[4-[2-chloro-3-[1-[[2-chloro-5-methoxy-4-(pyrrolidin-1-ylmethyl)phenyl]methyl]indazol-4-yl]phenyl]phenyl]methylamino]ethyl]formamide.
| Compound Name | N-[2-[[4-[2-chloro-3-[1-[[2-chloro-5-methoxy-4-(pyrrolidin-1-ylmethyl)phenyl]methyl]indazol-4-yl]phenyl]phenyl]methylamino]ethyl]formamide |
|---|---|
| PubChem CID | 167200883 |
| Molecular Formula | C36H37Cl2N5O2 |
| Molecular Weight | 642.63 g/mol |
| Exact Mass | 641.23 |
| IUPAC Name | N-[2-[[4-[2-chloro-3-[1-[[2-chloro-5-methoxy-4-(pyrrolidin-1-ylmethyl)phenyl]methyl]indazol-4-yl]phenyl]phenyl]methylamino]ethyl]formamide |
| SMILES | COc1cc(Cn2ncc3c(-c4cccc(-c5ccc(CNCCNC=O)cc5)c4Cl)cccc32)c(Cl)cc1CN1CCCC1 |
| InChI | InChI=1S/C36H37Cl2N5O2/c1-45-35-19-27(33(37)18-28(35)22-42-16-2-3-17-42)23-43-34-9-5-7-30(32(34)21-41-43)31-8-4-6-29(36(31)38)26-12-10-25(11-13-26)20-39-14-15-40-24-44/h4-13,18-19,21,24,39H,2-3,14-17,20,22-23H2,1H3,(H,40,44) |
| InChIKey | WZBQZIUJMMHKAJ-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 71.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.63 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|