C20H31NO3 — CID 167200921
[(3aS,4R,6aR)-5-benzyl-2-hexyl-2-methyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-4-yl]methanol (PubChem CID 167200921) has the molecular formula C20H31NO3 and a molecular weight of 333.47 g/mol. Its IUPAC name is [(3aS,4R,6aR)-5-benzyl-2-hexyl-2-methyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-4-yl]methanol.
| Compound Name | [(3aS,4R,6aR)-5-benzyl-2-hexyl-2-methyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-4-yl]methanol |
|---|---|
| PubChem CID | 167200921 |
| Molecular Formula | C20H31NO3 |
| Molecular Weight | 333.47 g/mol |
| Exact Mass | 333.23 |
| IUPAC Name | [(3aS,4R,6aR)-5-benzyl-2-hexyl-2-methyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-4-yl]methanol |
| SMILES | CCCCCCC1(C)O[C@H]2[C@@H](CO)N(Cc3ccccc3)C[C@H]2O1 |
| InChI | InChI=1S/C20H31NO3/c1-3-4-5-9-12-20(2)23-18-14-21(17(15-22)19(18)24-20)13-16-10-7-6-8-11-16/h6-8,10-11,17-19,22H,3-5,9,12-15H2,1-2H3/t17-,18-,19+,20?/m1/s1 |
| InChIKey | NEQZDOSYNVWNOD-WRURNZQNSA-N |
| XLogP | 3.33 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.47 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|