About 4-[(1E,3Z)-hepta-1,3-dienyl]-1H-indazole
4-[(1E,3Z)-hepta-1,3-dienyl]-1H-indazole (PubChem CID 167200953) has the molecular formula C14H16N2
and a molecular weight of 212.30 g/mol. Its IUPAC name is 4-[(1E,3Z)-hepta-1,3-dienyl]-1H-indazole.
Molecular Properties
| Compound Name | 4-[(1E,3Z)-hepta-1,3-dienyl]-1H-indazole |
| PubChem CID | 167200953 |
| Molecular Formula | C14H16N2 |
| Molecular Weight | 212.30 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | 4-[(1E,3Z)-hepta-1,3-dienyl]-1H-indazole |
| SMILES | CCC/C=C\C=C\c1cccc2[nH]ncc12 |
| InChI | InChI=1S/C14H16N2/c1-2-3-4-5-6-8-12-9-7-10-14-13(12)11-15-16-14/h4-11H,2-3H2,1H3,(H,15,16)/b5-4-,8-6+ |
| InChIKey | KLFCAMPZTWWMTK-GSGSLZOQSA-N |
| XLogP | 3.93 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.30 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 4-[(1E,3Z)-hepta-1,3-dienyl]-1H-indazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(1E,3Z)-hepta-1,3-dienyl]-1H-indazole?
The IUPAC name of 4-[(1E,3Z)-hepta-1,3-dienyl]-1H-indazole (CID 167200953) is 4-[(1E,3Z)-hepta-1,3-dienyl]-1H-indazole.
What is the SMILES notation for 4-[(1E,3Z)-hepta-1,3-dienyl]-1H-indazole?
The canonical SMILES for 4-[(1E,3Z)-hepta-1,3-dienyl]-1H-indazole is CCC/C=C\C=C\c1cccc2[nH]ncc12.
What is the InChIKey of 4-[(1E,3Z)-hepta-1,3-dienyl]-1H-indazole?
The InChIKey is KLFCAMPZTWWMTK-GSGSLZOQSA-N. The full InChI is InChI=1S/C14H16N2/c1-2-3-4-5-6-8-12-9-7-10-14-13(12)11-15-16-14/h4-11H,2-3H2,1H3,(H,15,16)/b5-4-,8-6+.
What are the key properties of 4-[(1E,3Z)-hepta-1,3-dienyl]-1H-indazole?
4-[(1E,3Z)-hepta-1,3-dienyl]-1H-indazole has a molecular weight of 212.30 g/mol, XLogP of 3.93, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(1E,3Z)-hepta-1,3-dienyl]-1H-indazole is sourced from PubChem (CID 167200953), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).