C15H26N2 — CID 167201274
1-[(3Z)-hexa-1,3,5-trien-2-yl]-1,2-dimethyl-2-[(Z)-2-methylhex-3-en-2-yl]hydrazine (PubChem CID 167201274) has the molecular formula C15H26N2 and a molecular weight of 234.39 g/mol. Its IUPAC name is 1-[(3Z)-hexa-1,3,5-trien-2-yl]-1,2-dimethyl-2-[(Z)-2-methylhex-3-en-2-yl]hydrazine.
| Compound Name | 1-[(3Z)-hexa-1,3,5-trien-2-yl]-1,2-dimethyl-2-[(Z)-2-methylhex-3-en-2-yl]hydrazine |
|---|---|
| PubChem CID | 167201274 |
| Molecular Formula | C15H26N2 |
| Molecular Weight | 234.39 g/mol |
| Exact Mass | 234.21 |
| IUPAC Name | 1-[(3Z)-hexa-1,3,5-trien-2-yl]-1,2-dimethyl-2-[(Z)-2-methylhex-3-en-2-yl]hydrazine |
| SMILES | C=C/C=C\C(=C)N(C)N(C)C(C)(C)/C=C\CC |
| InChI | InChI=1S/C15H26N2/c1-8-10-12-14(3)16(6)17(7)15(4,5)13-11-9-2/h8,10-13H,1,3,9H2,2,4-7H3/b12-10-,13-11- |
| InChIKey | XWBVDBOGMBUJAJ-MIMPSMLTSA-N |
| XLogP | 3.77 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.39 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|