About 2-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]-1,3,2-benzodioxaborole
2-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]-1,3,2-benzodioxaborole (PubChem CID 16720138) has the molecular formula C15H10BF3O2
and a molecular weight of 290.05 g/mol. Its IUPAC name is 2-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]-1,3,2-benzodioxaborole.
Molecular Properties
| Compound Name | 2-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]-1,3,2-benzodioxaborole |
| PubChem CID | 16720138 |
| Molecular Formula | C15H10BF3O2 |
| Molecular Weight | 290.05 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | 2-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]-1,3,2-benzodioxaborole |
| SMILES | FC(F)(F)c1ccc(/C=C/B2Oc3ccccc3O2)cc1 |
| InChI | InChI=1S/C15H10BF3O2/c17-15(18,19)12-7-5-11(6-8-12)9-10-16-20-13-3-1-2-4-14(13)21-16/h1-10H/b10-9+ |
| InChIKey | SZVPYZGDSHLYEA-MDZDMXLPSA-N |
| XLogP | 4.22 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.05 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]-1,3,2-benzodioxaborole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]-1,3,2-benzodioxaborole?
The IUPAC name of 2-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]-1,3,2-benzodioxaborole (CID 16720138) is 2-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]-1,3,2-benzodioxaborole.
What is the SMILES notation for 2-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]-1,3,2-benzodioxaborole?
The canonical SMILES for 2-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]-1,3,2-benzodioxaborole is FC(F)(F)c1ccc(/C=C/B2Oc3ccccc3O2)cc1.
What is the InChIKey of 2-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]-1,3,2-benzodioxaborole?
The InChIKey is SZVPYZGDSHLYEA-MDZDMXLPSA-N. The full InChI is InChI=1S/C15H10BF3O2/c17-15(18,19)12-7-5-11(6-8-12)9-10-16-20-13-3-1-2-4-14(13)21-16/h1-10H/b10-9+.
What are the key properties of 2-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]-1,3,2-benzodioxaborole?
2-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]-1,3,2-benzodioxaborole has a molecular weight of 290.05 g/mol, XLogP of 4.22, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]-1,3,2-benzodioxaborole is sourced from PubChem (CID 16720138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).