C22H28N10O13P2 — CID 167201407
2-amino-9-[8-(6-aminopurin-9-yl)-3,9,12-trihydroxy-18-(2-hydroxyethyl)-3,12-dioxo-2,4,7,11,13,16-hexaoxa-3λ5,12λ5-diphosphatricyclo[13.2.1.06,10]octadecan-17-yl]-1H-purin-6-one (PubChem CID 167201407) has the molecular formula C22H28N10O13P2 and a molecular weight of 702.47 g/mol. Its IUPAC name is 2-amino-9-[8-(6-aminopurin-9-yl)-3,9,12-trihydroxy-18-(2-hydroxyethyl)-3,12-dioxo-2,4,7,11,13,16-hexaoxa-3λ5,12λ5-diphosphatricyclo[13.2.1.06,10]octadecan-17-yl]-1H-purin-6-one.
| Compound Name | 2-amino-9-[8-(6-aminopurin-9-yl)-3,9,12-trihydroxy-18-(2-hydroxyethyl)-3,12-dioxo-2,4,7,11,13,16-hexaoxa-3λ5,12λ5-diphosphatricyclo[13.2.1.06,10]octadecan-17-yl]-1H-purin-6-one |
|---|---|
| PubChem CID | 167201407 |
| Molecular Formula | C22H28N10O13P2 |
| Molecular Weight | 702.47 g/mol |
| Exact Mass | 702.13 |
| IUPAC Name | 2-amino-9-[8-(6-aminopurin-9-yl)-3,9,12-trihydroxy-18-(2-hydroxyethyl)-3,12-dioxo-2,4,7,11,13,16-hexaoxa-3λ5,12λ5-diphosphatricyclo[13.2.1.06,10]octadecan-17-yl]-1H-purin-6-one |
| SMILES | Nc1nc2c(ncn2C2OC3COP(=O)(O)OC4C(COP(=O)(O)OC2C3CCO)OC(n2cnc3c(N)ncnc32)C4O)c(=O)[nH]1 |
| InChI | InChI=1S/C22H28N10O13P2/c23-16-11-17(26-5-25-16)31(6-27-11)20-13(34)15-10(43-20)4-41-46(36,37)44-14-8(1-2-33)9(3-40-47(38,39)45-15)42-21(14)32-7-28-12-18(32)29-22(24)30-19(12)35/h5-10,13-15,20-21,33-34H,1-4H2,(H,36,37)(H,38,39)(H2,23,25,26)(H3,24,29,30,35) |
| InChIKey | JKFQOODHZIJUTQ-UHFFFAOYSA-N |
| XLogP | -1.70 |
| TPSA | 329.65 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.47 |
| LogP ≤ 5 | -1.70 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 20 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|