About 2-methyl-N'-[(1Z,3Z)-3-propan-2-ylpenta-1,3-dienyl]propanimidamide
2-methyl-N'-[(1Z,3Z)-3-propan-2-ylpenta-1,3-dienyl]propanimidamide (PubChem CID 167202059) has the molecular formula C12H22N2
and a molecular weight of 194.32 g/mol. Its IUPAC name is 2-methyl-N'-[(1Z,3Z)-3-propan-2-ylpenta-1,3-dienyl]propanimidamide.
Molecular Properties
| Compound Name | 2-methyl-N'-[(1Z,3Z)-3-propan-2-ylpenta-1,3-dienyl]propanimidamide |
| PubChem CID | 167202059 |
| Molecular Formula | C12H22N2 |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.18 |
| IUPAC Name | 2-methyl-N'-[(1Z,3Z)-3-propan-2-ylpenta-1,3-dienyl]propanimidamide |
| SMILES | C/C=C(\C=C/N=C(/N)C(C)C)C(C)C |
| InChI | InChI=1S/C12H22N2/c1-6-11(9(2)3)7-8-14-12(13)10(4)5/h6-10H,1-5H3,(H2,13,14)/b8-7-,11-6+ |
| InChIKey | YZSGVFKBBNLVRC-YKFSIMETSA-N |
| XLogP | 3.12 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-N'-[(1Z,3Z)-3-propan-2-ylpenta-1,3-dienyl]propanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-N'-[(1Z,3Z)-3-propan-2-ylpenta-1,3-dienyl]propanimidamide?
The IUPAC name of 2-methyl-N'-[(1Z,3Z)-3-propan-2-ylpenta-1,3-dienyl]propanimidamide (CID 167202059) is 2-methyl-N'-[(1Z,3Z)-3-propan-2-ylpenta-1,3-dienyl]propanimidamide.
What is the SMILES notation for 2-methyl-N'-[(1Z,3Z)-3-propan-2-ylpenta-1,3-dienyl]propanimidamide?
The canonical SMILES for 2-methyl-N'-[(1Z,3Z)-3-propan-2-ylpenta-1,3-dienyl]propanimidamide is C/C=C(\C=C/N=C(/N)C(C)C)C(C)C.
What is the InChIKey of 2-methyl-N'-[(1Z,3Z)-3-propan-2-ylpenta-1,3-dienyl]propanimidamide?
The InChIKey is YZSGVFKBBNLVRC-YKFSIMETSA-N. The full InChI is InChI=1S/C12H22N2/c1-6-11(9(2)3)7-8-14-12(13)10(4)5/h6-10H,1-5H3,(H2,13,14)/b8-7-,11-6+.
What are the key properties of 2-methyl-N'-[(1Z,3Z)-3-propan-2-ylpenta-1,3-dienyl]propanimidamide?
2-methyl-N'-[(1Z,3Z)-3-propan-2-ylpenta-1,3-dienyl]propanimidamide has a molecular weight of 194.32 g/mol, XLogP of 3.12, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-N'-[(1Z,3Z)-3-propan-2-ylpenta-1,3-dienyl]propanimidamide is sourced from PubChem (CID 167202059), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).