C18H16N4O — CID 16720208
2-[2-(4-aminophenyl)-4-pyridinyl]-1,5,6,7-tetrahydropyrrolo[3,2-c]pyridin-4-one (PubChem CID 16720208) has the molecular formula C18H16N4O and a molecular weight of 304.35 g/mol. Its IUPAC name is 2-[2-(4-aminophenyl)-4-pyridinyl]-1,5,6,7-tetrahydropyrrolo[3,2-c]pyridin-4-one.
| Compound Name | 2-[2-(4-aminophenyl)-4-pyridinyl]-1,5,6,7-tetrahydropyrrolo[3,2-c]pyridin-4-one |
|---|---|
| PubChem CID | 16720208 |
| Molecular Formula | C18H16N4O |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | 2-[2-(4-aminophenyl)-4-pyridinyl]-1,5,6,7-tetrahydropyrrolo[3,2-c]pyridin-4-one |
| SMILES | Nc1ccc(-c2cc(-c3cc4c([nH]3)CCNC4=O)ccn2)cc1 |
| InChI | InChI=1S/C18H16N4O/c19-13-3-1-11(2-4-13)16-9-12(5-7-20-16)17-10-14-15(22-17)6-8-21-18(14)23/h1-5,7,9-10,22H,6,8,19H2,(H,21,23) |
| InChIKey | OVFRSUMNMCYPAW-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|