C28H50N2O3 — CID 167202101
3-(dimethylamino)propyl (2R,3S)-2-[(8Z,11Z)-heptadeca-8,11-dienyl]-1-methyl-5-oxopyrrolidine-3-carboxylate (PubChem CID 167202101) has the molecular formula C28H50N2O3 and a molecular weight of 462.72 g/mol. Its IUPAC name is 3-(dimethylamino)propyl (2R,3S)-2-[(8Z,11Z)-heptadeca-8,11-dienyl]-1-methyl-5-oxopyrrolidine-3-carboxylate.
| Compound Name | 3-(dimethylamino)propyl (2R,3S)-2-[(8Z,11Z)-heptadeca-8,11-dienyl]-1-methyl-5-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 167202101 |
| Molecular Formula | C28H50N2O3 |
| Molecular Weight | 462.72 g/mol |
| Exact Mass | 462.38 |
| IUPAC Name | 3-(dimethylamino)propyl (2R,3S)-2-[(8Z,11Z)-heptadeca-8,11-dienyl]-1-methyl-5-oxopyrrolidine-3-carboxylate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCC[C@@H]1[C@@H](C(=O)OCCCN(C)C)CC(=O)N1C |
| InChI | InChI=1S/C28H50N2O3/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-21-26-25(24-27(31)30(26)4)28(32)33-23-20-22-29(2)3/h9-10,12-13,25-26H,5-8,11,14-24H2,1-4H3/b10-9-,13-12-/t25-,26+/m0/s1 |
| InChIKey | ZIOSJORBOHPTGA-HLWFARRQSA-N |
| XLogP | 6.14 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.72 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|