C21H39N3O2 — CID 167202273
(2R,3S)-1-methyl-2-octyl-5-oxo-N-(2-piperidin-1-ylethyl)pyrrolidine-3-carboxamide (PubChem CID 167202273) has the molecular formula C21H39N3O2 and a molecular weight of 365.56 g/mol. Its IUPAC name is (2R,3S)-1-methyl-2-octyl-5-oxo-N-(2-piperidin-1-ylethyl)pyrrolidine-3-carboxamide.
| Compound Name | (2R,3S)-1-methyl-2-octyl-5-oxo-N-(2-piperidin-1-ylethyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 167202273 |
| Molecular Formula | C21H39N3O2 |
| Molecular Weight | 365.56 g/mol |
| Exact Mass | 365.30 |
| IUPAC Name | (2R,3S)-1-methyl-2-octyl-5-oxo-N-(2-piperidin-1-ylethyl)pyrrolidine-3-carboxamide |
| SMILES | CCCCCCCC[C@@H]1[C@@H](C(=O)NCCN2CCCCC2)CC(=O)N1C |
| InChI | InChI=1S/C21H39N3O2/c1-3-4-5-6-7-9-12-19-18(17-20(25)23(19)2)21(26)22-13-16-24-14-10-8-11-15-24/h18-19H,3-17H2,1-2H3,(H,22,26)/t18-,19+/m0/s1 |
| InChIKey | FVCNJAUXIZIGJK-RBUKOAKNSA-N |
| XLogP | 3.19 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.56 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|