About (3-ethoxyazetidin-1-yl) thiohypoiodite
(3-ethoxyazetidin-1-yl) thiohypoiodite (PubChem CID 167202371) has the molecular formula C5H10INOS
and a molecular weight of 259.11 g/mol. Its IUPAC name is (3-ethoxyazetidin-1-yl) thiohypoiodite.
Molecular Properties
| Compound Name | (3-ethoxyazetidin-1-yl) thiohypoiodite |
| PubChem CID | 167202371 |
| Molecular Formula | C5H10INOS |
| Molecular Weight | 259.11 g/mol |
| Exact Mass | 258.95 |
| IUPAC Name | (3-ethoxyazetidin-1-yl) thiohypoiodite |
| SMILES | CCOC1CN(SI)C1 |
| InChI | InChI=1S/C5H10INOS/c1-2-8-5-3-7(4-5)9-6/h5H,2-4H2,1H3 |
| InChIKey | WSGLJKUVSBREOO-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.11 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (3-ethoxyazetidin-1-yl) thiohypoiodite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-ethoxyazetidin-1-yl) thiohypoiodite?
The IUPAC name of (3-ethoxyazetidin-1-yl) thiohypoiodite (CID 167202371) is (3-ethoxyazetidin-1-yl) thiohypoiodite.
What is the SMILES notation for (3-ethoxyazetidin-1-yl) thiohypoiodite?
The canonical SMILES for (3-ethoxyazetidin-1-yl) thiohypoiodite is CCOC1CN(SI)C1.
What is the InChIKey of (3-ethoxyazetidin-1-yl) thiohypoiodite?
The InChIKey is WSGLJKUVSBREOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10INOS/c1-2-8-5-3-7(4-5)9-6/h5H,2-4H2,1H3.
What are the key properties of (3-ethoxyazetidin-1-yl) thiohypoiodite?
(3-ethoxyazetidin-1-yl) thiohypoiodite has a molecular weight of 259.11 g/mol, XLogP of 1.71, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-ethoxyazetidin-1-yl) thiohypoiodite is sourced from PubChem (CID 167202371), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).