C21H24Cl2N4O2 — CID 167202690
N-[[3-[2-[4-(2,3-dichlorophenyl)piperazin-1-yl]ethyl]cyclobutyl]methylidene]-1,3-oxazole-2-carboxamide (PubChem CID 167202690) has the molecular formula C21H24Cl2N4O2 and a molecular weight of 435.36 g/mol. Its IUPAC name is N-[[3-[2-[4-(2,3-dichlorophenyl)piperazin-1-yl]ethyl]cyclobutyl]methylidene]-1,3-oxazole-2-carboxamide.
| Compound Name | N-[[3-[2-[4-(2,3-dichlorophenyl)piperazin-1-yl]ethyl]cyclobutyl]methylidene]-1,3-oxazole-2-carboxamide |
|---|---|
| PubChem CID | 167202690 |
| Molecular Formula | C21H24Cl2N4O2 |
| Molecular Weight | 435.36 g/mol |
| Exact Mass | 434.13 |
| IUPAC Name | N-[[3-[2-[4-(2,3-dichlorophenyl)piperazin-1-yl]ethyl]cyclobutyl]methylidene]-1,3-oxazole-2-carboxamide |
| SMILES | O=C(/N=C/C1CC(CCN2CCN(c3cccc(Cl)c3Cl)CC2)C1)c1ncco1 |
| InChI | InChI=1S/C21H24Cl2N4O2/c22-17-2-1-3-18(19(17)23)27-9-7-26(8-10-27)6-4-15-12-16(13-15)14-25-20(28)21-24-5-11-29-21/h1-3,5,11,14-16H,4,6-10,12-13H2/b25-14+ |
| InChIKey | MYCTVAZTCPPHJA-AFUMVMLFSA-N |
| XLogP | 4.43 |
| TPSA | 61.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.36 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|