C17H24O5 — CID 16720293
[(E)-5,5-bis(hydroxymethyl)-6-(2-methylphenyl)hex-2-enyl] methyl carbonate (PubChem CID 16720293) has the molecular formula C17H24O5 and a molecular weight of 308.37 g/mol. Its IUPAC name is [(E)-5,5-bis(hydroxymethyl)-6-(2-methylphenyl)hex-2-enyl] methyl carbonate.
| Compound Name | [(E)-5,5-bis(hydroxymethyl)-6-(2-methylphenyl)hex-2-enyl] methyl carbonate |
|---|---|
| PubChem CID | 16720293 |
| Molecular Formula | C17H24O5 |
| Molecular Weight | 308.37 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | [(E)-5,5-bis(hydroxymethyl)-6-(2-methylphenyl)hex-2-enyl] methyl carbonate |
| SMILES | COC(=O)OC/C=C/CC(CO)(CO)Cc1ccccc1C |
| InChI | InChI=1S/C17H24O5/c1-14-7-3-4-8-15(14)11-17(12-18,13-19)9-5-6-10-22-16(20)21-2/h3-8,18-19H,9-13H2,1-2H3/b6-5+ |
| InChIKey | MDMWLAMEBRSWRJ-AATRIKPKSA-N |
| XLogP | 2.24 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.37 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|