About 1-[(3S,4R)-4-hydroxypyrrolidin-3-yl]ethanone
1-[(3S,4R)-4-hydroxypyrrolidin-3-yl]ethanone (PubChem CID 167202947) has the molecular formula C6H11NO2
and a molecular weight of 129.16 g/mol. Its IUPAC name is 1-[(3S,4R)-4-hydroxypyrrolidin-3-yl]ethanone.
Molecular Properties
| Compound Name | 1-[(3S,4R)-4-hydroxypyrrolidin-3-yl]ethanone |
| PubChem CID | 167202947 |
| Molecular Formula | C6H11NO2 |
| Molecular Weight | 129.16 g/mol |
| Exact Mass | 129.08 |
| IUPAC Name | 1-[(3S,4R)-4-hydroxypyrrolidin-3-yl]ethanone |
| SMILES | CC(=O)[C@H]1CNC[C@@H]1O |
| InChI | InChI=1S/C6H11NO2/c1-4(8)5-2-7-3-6(5)9/h5-7,9H,2-3H2,1H3/t5-,6+/m1/s1 |
| InChIKey | ONURPZAIZHYAQR-RITPCOANSA-N |
| XLogP | -0.84 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.16 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[(3S,4R)-4-hydroxypyrrolidin-3-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3S,4R)-4-hydroxypyrrolidin-3-yl]ethanone?
The IUPAC name of 1-[(3S,4R)-4-hydroxypyrrolidin-3-yl]ethanone (CID 167202947) is 1-[(3S,4R)-4-hydroxypyrrolidin-3-yl]ethanone.
What is the SMILES notation for 1-[(3S,4R)-4-hydroxypyrrolidin-3-yl]ethanone?
The canonical SMILES for 1-[(3S,4R)-4-hydroxypyrrolidin-3-yl]ethanone is CC(=O)[C@H]1CNC[C@@H]1O.
What is the InChIKey of 1-[(3S,4R)-4-hydroxypyrrolidin-3-yl]ethanone?
The InChIKey is ONURPZAIZHYAQR-RITPCOANSA-N. The full InChI is InChI=1S/C6H11NO2/c1-4(8)5-2-7-3-6(5)9/h5-7,9H,2-3H2,1H3/t5-,6+/m1/s1.
What are the key properties of 1-[(3S,4R)-4-hydroxypyrrolidin-3-yl]ethanone?
1-[(3S,4R)-4-hydroxypyrrolidin-3-yl]ethanone has a molecular weight of 129.16 g/mol, XLogP of -0.84, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3S,4R)-4-hydroxypyrrolidin-3-yl]ethanone is sourced from PubChem (CID 167202947), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).