C17H15N3O3 — CID 167203151
5-[(1Z)-buta-1,3-dienyl]-4-methyl-N-(2-oxo-1,3-dihydrobenzimidazol-5-yl)furan-3-carboxamide (PubChem CID 167203151) has the molecular formula C17H15N3O3 and a molecular weight of 309.33 g/mol. Its IUPAC name is 5-[(1Z)-buta-1,3-dienyl]-4-methyl-N-(2-oxo-1,3-dihydrobenzimidazol-5-yl)furan-3-carboxamide.
| Compound Name | 5-[(1Z)-buta-1,3-dienyl]-4-methyl-N-(2-oxo-1,3-dihydrobenzimidazol-5-yl)furan-3-carboxamide |
|---|---|
| PubChem CID | 167203151 |
| Molecular Formula | C17H15N3O3 |
| Molecular Weight | 309.33 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | 5-[(1Z)-buta-1,3-dienyl]-4-methyl-N-(2-oxo-1,3-dihydrobenzimidazol-5-yl)furan-3-carboxamide |
| SMILES | C=C/C=C\c1occ(C(=O)Nc2ccc3[nH]c(=O)[nH]c3c2)c1C |
| InChI | InChI=1S/C17H15N3O3/c1-3-4-5-15-10(2)12(9-23-15)16(21)18-11-6-7-13-14(8-11)20-17(22)19-13/h3-9H,1H2,2H3,(H,18,21)(H2,19,20,22)/b5-4- |
| InChIKey | KZANLIVIULRPAA-PLNGDYQASA-N |
| XLogP | 3.21 |
| TPSA | 90.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.33 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|