C30H34N6O4 — CID 167203319
N-[2-[[3-(3,5-dimethoxyphenyl)-1-methyl-2-oxo-4H-pyrimido[4,5-d]pyrimidin-7-yl]amino]-4-phenylcyclohexyl]prop-2-enamide (PubChem CID 167203319) has the molecular formula C30H34N6O4 and a molecular weight of 542.64 g/mol. Its IUPAC name is N-[2-[[3-(3,5-dimethoxyphenyl)-1-methyl-2-oxo-4H-pyrimido[4,5-d]pyrimidin-7-yl]amino]-4-phenylcyclohexyl]prop-2-enamide.
| Compound Name | N-[2-[[3-(3,5-dimethoxyphenyl)-1-methyl-2-oxo-4H-pyrimido[4,5-d]pyrimidin-7-yl]amino]-4-phenylcyclohexyl]prop-2-enamide |
|---|---|
| PubChem CID | 167203319 |
| Molecular Formula | C30H34N6O4 |
| Molecular Weight | 542.64 g/mol |
| Exact Mass | 542.26 |
| IUPAC Name | N-[2-[[3-(3,5-dimethoxyphenyl)-1-methyl-2-oxo-4H-pyrimido[4,5-d]pyrimidin-7-yl]amino]-4-phenylcyclohexyl]prop-2-enamide |
| SMILES | C=CC(=O)NC1CCC(c2ccccc2)CC1Nc1ncc2c(n1)N(C)C(=O)N(c1cc(OC)cc(OC)c1)C2 |
| InChI | InChI=1S/C30H34N6O4/c1-5-27(37)32-25-12-11-20(19-9-7-6-8-10-19)13-26(25)33-29-31-17-21-18-36(30(38)35(2)28(21)34-29)22-14-23(39-3)16-24(15-22)40-4/h5-10,14-17,20,25-26H,1,11-13,18H2,2-4H3,(H,32,37)(H,31,33,34) |
| InChIKey | FSASRLOTVFPNBW-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 108.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.64 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|