C16H25F3N2O2 — CID 167203414
N-[(2S)-3,3-dimethyl-1-oxo-1-[(1R,2R)-2,6,6-trimethyl-3-azabicyclo[3.1.0]hexan-3-yl]butan-2-yl]-2,2,2-trifluoroacetamide (PubChem CID 167203414) has the molecular formula C16H25F3N2O2 and a molecular weight of 334.38 g/mol. Its IUPAC name is N-[(2S)-3,3-dimethyl-1-oxo-1-[(1R,2R)-2,6,6-trimethyl-3-azabicyclo[3.1.0]hexan-3-yl]butan-2-yl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[(2S)-3,3-dimethyl-1-oxo-1-[(1R,2R)-2,6,6-trimethyl-3-azabicyclo[3.1.0]hexan-3-yl]butan-2-yl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 167203414 |
| Molecular Formula | C16H25F3N2O2 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | N-[(2S)-3,3-dimethyl-1-oxo-1-[(1R,2R)-2,6,6-trimethyl-3-azabicyclo[3.1.0]hexan-3-yl]butan-2-yl]-2,2,2-trifluoroacetamide |
| SMILES | C[C@@H]1[C@@H]2C(CN1C(=O)[C@@H](NC(=O)C(F)(F)F)C(C)(C)C)C2(C)C |
| InChI | InChI=1S/C16H25F3N2O2/c1-8-10-9(15(10,5)6)7-21(8)12(22)11(14(2,3)4)20-13(23)16(17,18)19/h8-11H,7H2,1-6H3,(H,20,23)/t8-,9?,10-,11-/m1/s1 |
| InChIKey | RADRFUHUGVRGOQ-CBSBEWHRSA-N |
| XLogP | 2.58 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |