About 5-ethyl-3-N-methyl-3,4-dihydropyridine-3,6-diamine
5-ethyl-3-N-methyl-3,4-dihydropyridine-3,6-diamine (PubChem CID 167203549) has the molecular formula C8H15N3
and a molecular weight of 153.23 g/mol. Its IUPAC name is 5-ethyl-3-N-methyl-3,4-dihydropyridine-3,6-diamine.
Analyze 5-ethyl-3-N-methyl-3,4-dihydropyridine-3,6-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-3-N-methyl-3,4-dihydropyridine-3,6-diamine?
The IUPAC name of 5-ethyl-3-N-methyl-3,4-dihydropyridine-3,6-diamine (CID 167203549) is 5-ethyl-3-N-methyl-3,4-dihydropyridine-3,6-diamine.
What is the SMILES notation for 5-ethyl-3-N-methyl-3,4-dihydropyridine-3,6-diamine?
The canonical SMILES for 5-ethyl-3-N-methyl-3,4-dihydropyridine-3,6-diamine is CCC1=C(N)N=CC(NC)C1.
What is the InChIKey of 5-ethyl-3-N-methyl-3,4-dihydropyridine-3,6-diamine?
The InChIKey is RGECUGYVKFHJFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15N3/c1-3-6-4-7(10-2)5-11-8(6)9/h5,7,10H,3-4,9H2,1-2H3.
What are the key properties of 5-ethyl-3-N-methyl-3,4-dihydropyridine-3,6-diamine?
5-ethyl-3-N-methyl-3,4-dihydropyridine-3,6-diamine has a molecular weight of 153.23 g/mol, XLogP of 0.63, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-3-N-methyl-3,4-dihydropyridine-3,6-diamine is sourced from PubChem (CID 167203549), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).