About 7-triethylsilylhepta-2,4,6-triynyl acetate
7-triethylsilylhepta-2,4,6-triynyl acetate (PubChem CID 16720380) has the molecular formula C15H20O2Si
and a molecular weight of 260.41 g/mol. Its IUPAC name is 7-triethylsilylhepta-2,4,6-triynyl acetate.
Molecular Properties
| Compound Name | 7-triethylsilylhepta-2,4,6-triynyl acetate |
| PubChem CID | 16720380 |
| Molecular Formula | C15H20O2Si |
| Molecular Weight | 260.41 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | 7-triethylsilylhepta-2,4,6-triynyl acetate |
| SMILES | CC[Si](C#CC#CC#CCOC(C)=O)(CC)CC |
| InChI | InChI=1S/C15H20O2Si/c1-5-18(6-2,7-3)14-12-10-8-9-11-13-17-15(4)16/h5-7,13H2,1-4H3 |
| InChIKey | OWQNORYQFCRQIH-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.41 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 7-triethylsilylhepta-2,4,6-triynyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-triethylsilylhepta-2,4,6-triynyl acetate?
The IUPAC name of 7-triethylsilylhepta-2,4,6-triynyl acetate (CID 16720380) is 7-triethylsilylhepta-2,4,6-triynyl acetate.
What is the SMILES notation for 7-triethylsilylhepta-2,4,6-triynyl acetate?
The canonical SMILES for 7-triethylsilylhepta-2,4,6-triynyl acetate is CC[Si](C#CC#CC#CCOC(C)=O)(CC)CC.
What is the InChIKey of 7-triethylsilylhepta-2,4,6-triynyl acetate?
The InChIKey is OWQNORYQFCRQIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20O2Si/c1-5-18(6-2,7-3)14-12-10-8-9-11-13-17-15(4)16/h5-7,13H2,1-4H3.
What are the key properties of 7-triethylsilylhepta-2,4,6-triynyl acetate?
7-triethylsilylhepta-2,4,6-triynyl acetate has a molecular weight of 260.41 g/mol, XLogP of 2.61, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-triethylsilylhepta-2,4,6-triynyl acetate is sourced from PubChem (CID 16720380), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).