C18H31FN2 — CID 167204291
(E)-3-[(2E,4Z)-6-fluorohepta-2,4,6-trien-2-yl]-N'-methyl-N,N-dipropylbut-1-ene-1,4-diamine (PubChem CID 167204291) has the molecular formula C18H31FN2 and a molecular weight of 294.46 g/mol. Its IUPAC name is (E)-3-[(2E,4Z)-6-fluorohepta-2,4,6-trien-2-yl]-N'-methyl-N,N-dipropylbut-1-ene-1,4-diamine.
| Compound Name | (E)-3-[(2E,4Z)-6-fluorohepta-2,4,6-trien-2-yl]-N'-methyl-N,N-dipropylbut-1-ene-1,4-diamine |
|---|---|
| PubChem CID | 167204291 |
| Molecular Formula | C18H31FN2 |
| Molecular Weight | 294.46 g/mol |
| Exact Mass | 294.25 |
| IUPAC Name | (E)-3-[(2E,4Z)-6-fluorohepta-2,4,6-trien-2-yl]-N'-methyl-N,N-dipropylbut-1-ene-1,4-diamine |
| SMILES | C=C(F)/C=C\C=C(/C)C(/C=C/N(CCC)CCC)CNC |
| InChI | InChI=1S/C18H31FN2/c1-6-12-21(13-7-2)14-11-18(15-20-5)16(3)9-8-10-17(4)19/h8-11,14,18,20H,4,6-7,12-13,15H2,1-3,5H3/b10-8-,14-11+,16-9+ |
| InChIKey | YCIDLPQJYUFFDC-LNWOKRDPSA-N |
| XLogP | 4.44 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.46 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|