C10H16FN — CID 167204492
6-fluoro-4-methyl-1,2,4a,5,6,7,8,8a-octahydroquinoline (PubChem CID 167204492) has the molecular formula C10H16FN and a molecular weight of 169.24 g/mol. Its IUPAC name is 6-fluoro-4-methyl-1,2,4a,5,6,7,8,8a-octahydroquinoline.
| Compound Name | 6-fluoro-4-methyl-1,2,4a,5,6,7,8,8a-octahydroquinoline |
|---|---|
| PubChem CID | 167204492 |
| Molecular Formula | C10H16FN |
| Molecular Weight | 169.24 g/mol |
| Exact Mass | 169.13 |
| IUPAC Name | 6-fluoro-4-methyl-1,2,4a,5,6,7,8,8a-octahydroquinoline |
| SMILES | CC1=CCNC2CCC(F)CC12 |
| InChI | InChI=1S/C10H16FN/c1-7-4-5-12-10-3-2-8(11)6-9(7)10/h4,8-10,12H,2-3,5-6H2,1H3 |
| InChIKey | JUGBGRSFMUWIPZ-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.24 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|